C12H12N2O6S3 — CID 25188599
[2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] methanesulfonate (PubChem CID 25188599) has the molecular formula C12H12N2O6S3 and a molecular weight of 376.44 g/mol. Its IUPAC name is [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] methanesulfonate.
| Compound Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 25188599 |
| Molecular Formula | C12H12N2O6S3 |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccccc1C(=O)Nc1ncc(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C12H12N2O6S3/c1-22(16,17)10-7-13-12(21-10)14-11(15)8-5-3-4-6-9(8)20-23(2,18)19/h3-7H,1-2H3,(H,13,14,15) |
| InChIKey | CLZNEPULZMTTLH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|