C13H12N2O5S2 — CID 25188602
4-methyl-2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]benzoic acid (PubChem CID 25188602) has the molecular formula C13H12N2O5S2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-methyl-2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]benzoic acid.
| Compound Name | 4-methyl-2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 25188602 |
| Molecular Formula | C13H12N2O5S2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 4-methyl-2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(C(=O)Nc2ncc(S(C)(=O)=O)s2)c1 |
| InChI | InChI=1S/C13H12N2O5S2/c1-7-3-4-8(12(17)18)9(5-7)11(16)15-13-14-6-10(21-13)22(2,19)20/h3-6H,1-2H3,(H,17,18)(H,14,15,16) |
| InChIKey | DAENHJDGHIPLQT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |