C12H10N3O3S- — CID 6941940
4-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]benzoate (PubChem CID 6941940) has the molecular formula C12H10N3O3S- and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]benzoate.
| Compound Name | 4-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 6941940 |
| Molecular Formula | C12H10N3O3S- |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 4-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]benzoate |
| SMILES | Cc1ccc(C(=O)[O-])c(C(=O)Nc2nnc(C)s2)c1 |
| InChI | InChI=1S/C12H11N3O3S/c1-6-3-4-8(11(17)18)9(5-6)10(16)13-12-15-14-7(2)19-12/h3-5H,1-2H3,(H,17,18)(H,13,15,16)/p-1 |
| InChIKey | RDOAGXGPWOWCFV-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |