C10H9FN4OS — CID 115597803
5-amino-2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 115597803) has the molecular formula C10H9FN4OS and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 5-amino-2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 115597803 |
| Molecular Formula | C10H9FN4OS |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 5-amino-2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | Cc1nnc(NC(=O)c2cc(N)ccc2F)s1 |
| InChI | InChI=1S/C10H9FN4OS/c1-5-14-15-10(17-5)13-9(16)7-4-6(12)2-3-8(7)11/h2-4H,12H2,1H3,(H,13,15,16) |
| InChIKey | GRQJIKUEZFCCOM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|