C11H12N4O3S2 — CID 31265617
2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-sulfamoylbenzamide (PubChem CID 31265617) has the molecular formula C11H12N4O3S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-sulfamoylbenzamide.
| Compound Name | 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 31265617 |
| Molecular Formula | C11H12N4O3S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-sulfamoylbenzamide |
| SMILES | Cc1nnc(NC(=O)c2cc(S(N)(=O)=O)ccc2C)s1 |
| InChI | InChI=1S/C11H12N4O3S2/c1-6-3-4-8(20(12,17)18)5-9(6)10(16)13-11-15-14-7(2)19-11/h3-5H,1-2H3,(H2,12,17,18)(H,13,15,16) |
| InChIKey | OJVFFCKUGMEUBV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |