C11H11N3O2S — CID 113357489
4-hydroxy-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 113357489) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-hydroxy-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 113357489 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-hydroxy-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | Cc1nnc(NC(=O)c2ccc(O)c(C)c2)s1 |
| InChI | InChI=1S/C11H11N3O2S/c1-6-5-8(3-4-9(6)15)10(16)12-11-14-13-7(2)17-11/h3-5,15H,1-2H3,(H,12,14,16) |
| InChIKey | AVRILGPHPQRCAN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |