C12H11N3O3S — CID 46493816
methyl 3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]benzoate (PubChem CID 46493816) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is methyl 3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]benzoate.
| Compound Name | methyl 3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 46493816 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | methyl 3-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)Nc2nnc(C)s2)c1 |
| InChI | InChI=1S/C12H11N3O3S/c1-7-14-15-12(19-7)13-10(16)8-4-3-5-9(6-8)11(17)18-2/h3-6H,1-2H3,(H,13,15,16) |
| InChIKey | OOXRACMDIKDPHD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |