C13H10N4OS — CID 110485085
N-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinoline-6-carboxamide (PubChem CID 110485085) has the molecular formula C13H10N4OS and a molecular weight of 270.32 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinoline-6-carboxamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 110485085 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinoline-6-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2ccc3cnccc3c2)s1 |
| InChI | InChI=1S/C13H10N4OS/c1-8-16-17-13(19-8)15-12(18)10-2-3-11-7-14-5-4-9(11)6-10/h2-7H,1H3,(H,15,17,18) |
| InChIKey | IWHASIRQVFJOMJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |