C15H20N4O4S2 — CID 25488827
2-methoxy-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-5-sulfamoylbenzamide (PubChem CID 25488827) has the molecular formula C15H20N4O4S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-methoxy-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-5-sulfamoylbenzamide.
| Compound Name | 2-methoxy-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 25488827 |
| Molecular Formula | C15H20N4O4S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-methoxy-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-5-sulfamoylbenzamide |
| SMILES | CCC(CC)c1nnc(NC(=O)c2cc(S(N)(=O)=O)ccc2OC)s1 |
| InChI | InChI=1S/C15H20N4O4S2/c1-4-9(5-2)14-18-19-15(24-14)17-13(20)11-8-10(25(16,21)22)6-7-12(11)23-3/h6-9H,4-5H2,1-3H3,(H2,16,21,22)(H,17,19,20) |
| InChIKey | CBOVMSLQRSMMNI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |