About 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide
5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide (PubChem CID 115597844) has the molecular formula C12H11N5OS
and a molecular weight of 273.32 g/mol. Its IUPAC name is 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide |
| PubChem CID | 115597844 |
| Molecular Formula | C12H11N5OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2cc3cc(N)ccc3[nH]2)s1 |
| InChI | InChI=1S/C12H11N5OS/c1-6-16-17-12(19-6)15-11(18)10-5-7-4-8(13)2-3-9(7)14-10/h2-5,14H,13H2,1H3,(H,15,17,18) |
| InChIKey | FWVMMYBAWLDZPO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide?
The IUPAC name of 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide (CID 115597844) is 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide.
What is the SMILES notation for 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide?
The canonical SMILES for 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide is Cc1nnc(NC(=O)c2cc3cc(N)ccc3[nH]2)s1.
What is the InChIKey of 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide?
The InChIKey is FWVMMYBAWLDZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5OS/c1-6-16-17-12(19-6)15-11(18)10-5-7-4-8(13)2-3-9(7)14-10/h2-5,14H,13H2,1H3,(H,15,17,18).
What are the key properties of 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide?
5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide has a molecular weight of 273.32 g/mol, XLogP of 2.16, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-indole-2-carboxamide is sourced from PubChem (CID 115597844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).