C11H13N5O — CID 70215186
5-amino-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide (PubChem CID 70215186) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 5-amino-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide.
| Compound Name | 5-amino-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70215186 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 5-amino-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2cc(N)ccc2[nH]1 |
| InChI | InChI=1S/C11H13N5O/c1-14-11(13)16-10(17)9-5-6-4-7(12)2-3-8(6)15-9/h2-5,15H,12H2,1H3,(H3,13,14,16,17) |
| InChIKey | VSLXNVXFXUANGZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|