C13H12N4O2 — CID 63117740
5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-2-carboxamide (PubChem CID 63117740) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-2-carboxamide.
| Compound Name | 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 63117740 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 5-amino-N-(3-methyl-1,2-oxazol-5-yl)-1H-indole-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc3cc(N)ccc3[nH]2)on1 |
| InChI | InChI=1S/C13H12N4O2/c1-7-4-12(19-17-7)16-13(18)11-6-8-5-9(14)2-3-10(8)15-11/h2-6,15H,14H2,1H3,(H,16,18) |
| InChIKey | WSACMLOCNHJBRI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|