C15H14BrFN2O — CID 107571074
5-amino-N-(4-bromo-3,5-dimethylphenyl)-2-fluorobenzamide (PubChem CID 107571074) has the molecular formula C15H14BrFN2O and a molecular weight of 337.19 g/mol. Its IUPAC name is 5-amino-N-(4-bromo-3,5-dimethylphenyl)-2-fluorobenzamide.
| Compound Name | 5-amino-N-(4-bromo-3,5-dimethylphenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 107571074 |
| Molecular Formula | C15H14BrFN2O |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 5-amino-N-(4-bromo-3,5-dimethylphenyl)-2-fluorobenzamide |
| SMILES | Cc1cc(NC(=O)c2cc(N)ccc2F)cc(C)c1Br |
| InChI | InChI=1S/C15H14BrFN2O/c1-8-5-11(6-9(2)14(8)16)19-15(20)12-7-10(18)3-4-13(12)17/h3-7H,18H2,1-2H3,(H,19,20) |
| InChIKey | ZJCBWCOLSKRVFE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|