C17H18BrNO — CID 107574857
N-(4-bromo-3,5-dimethylphenyl)-2,5-dimethylbenzamide (PubChem CID 107574857) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-2,5-dimethylbenzamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 107574857 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)Nc2cc(C)c(Br)c(C)c2)c1 |
| InChI | InChI=1S/C17H18BrNO/c1-10-5-6-11(2)15(7-10)17(20)19-14-8-12(3)16(18)13(4)9-14/h5-9H,1-4H3,(H,19,20) |
| InChIKey | CTCIQNRFDKGIGP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |