C15H14ClNO — CID 925340
N-(2-chlorophenyl)-2,5-dimethylbenzamide (PubChem CID 925340) has the molecular formula C15H14ClNO and a molecular weight of 259.74 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2,5-dimethylbenzamide.
| Compound Name | N-(2-chlorophenyl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 925340 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-(2-chlorophenyl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H14ClNO/c1-10-7-8-11(2)12(9-10)15(18)17-14-6-4-3-5-13(14)16/h3-9H,1-2H3,(H,17,18) |
| InChIKey | OLEMVUCQYKNTRA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |