C20H16Cl2N2O2 — CID 55729425
N-[2-[(3,5-dichloro-2-pyridinyl)oxy]phenyl]-2,5-dimethylbenzamide (PubChem CID 55729425) has the molecular formula C20H16Cl2N2O2 and a molecular weight of 387.27 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)oxy]phenyl]-2,5-dimethylbenzamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]phenyl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 55729425 |
| Molecular Formula | C20H16Cl2N2O2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]phenyl]-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)Nc2ccccc2Oc2ncc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N2O2/c1-12-7-8-13(2)15(9-12)19(25)24-17-5-3-4-6-18(17)26-20-16(22)10-14(21)11-23-20/h3-11H,1-2H3,(H,24,25) |
| InChIKey | GJWNBEAMQSORHL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |