C22H17Cl2F2N3O3 — CID 112831231
N-[4-[2-[(3,5-dichloro-2-pyridinyl)oxy]anilino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 112831231) has the molecular formula C22H17Cl2F2N3O3 and a molecular weight of 480.30 g/mol. Its IUPAC name is N-[4-[2-[(3,5-dichloro-2-pyridinyl)oxy]anilino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[2-[(3,5-dichloro-2-pyridinyl)oxy]anilino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 112831231 |
| Molecular Formula | C22H17Cl2F2N3O3 |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | N-[4-[2-[(3,5-dichloro-2-pyridinyl)oxy]anilino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)Nc1ccccc1Oc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl2F2N3O3/c23-13-10-16(24)22(28-12-13)32-19-5-2-1-4-18(19)29-20(30)6-3-9-27-21(31)15-8-7-14(25)11-17(15)26/h1-2,4-5,7-8,10-12H,3,6,9H2,(H,27,31)(H,29,30) |
| InChIKey | NZUBFWGCLQLYGH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|