C21H23F2N3O3 — CID 24681937
N-[4-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 24681937) has the molecular formula C21H23F2N3O3 and a molecular weight of 403.43 g/mol. Its IUPAC name is N-[4-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 24681937 |
| Molecular Formula | C21H23F2N3O3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[4-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | Cc1cccc(NC(=O)CNC(=O)CCCNC(=O)c2ccc(F)cc2F)c1C |
| InChI | InChI=1S/C21H23F2N3O3/c1-13-5-3-6-18(14(13)2)26-20(28)12-25-19(27)7-4-10-24-21(29)16-9-8-15(22)11-17(16)23/h3,5-6,8-9,11H,4,7,10,12H2,1-2H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | XXUHGFVJUQRSOY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|