C22H23F2N3O3 — CID 46467552
N-[4-[5-(cyclopropanecarbonylamino)-2-methylanilino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 46467552) has the molecular formula C22H23F2N3O3 and a molecular weight of 415.44 g/mol. Its IUPAC name is N-[4-[5-(cyclopropanecarbonylamino)-2-methylanilino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[5-(cyclopropanecarbonylamino)-2-methylanilino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 46467552 |
| Molecular Formula | C22H23F2N3O3 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[4-[5-(cyclopropanecarbonylamino)-2-methylanilino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | Cc1ccc(NC(=O)C2CC2)cc1NC(=O)CCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H23F2N3O3/c1-13-4-8-16(26-21(29)14-5-6-14)12-19(13)27-20(28)3-2-10-25-22(30)17-9-7-15(23)11-18(17)24/h4,7-9,11-12,14H,2-3,5-6,10H2,1H3,(H,25,30)(H,26,29)(H,27,28) |
| InChIKey | VCTYHVDSOMNTTK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|