C16H15Br2NO — CID 107575045
3-bromo-N-(4-bromo-3,5-dimethylphenyl)-2-methylbenzamide (PubChem CID 107575045) has the molecular formula C16H15Br2NO and a molecular weight of 397.11 g/mol. Its IUPAC name is 3-bromo-N-(4-bromo-3,5-dimethylphenyl)-2-methylbenzamide.
| Compound Name | 3-bromo-N-(4-bromo-3,5-dimethylphenyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 107575045 |
| Molecular Formula | C16H15Br2NO |
| Molecular Weight | 397.11 g/mol |
| Exact Mass | 394.95 |
| IUPAC Name | 3-bromo-N-(4-bromo-3,5-dimethylphenyl)-2-methylbenzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(Br)c2C)cc(C)c1Br |
| InChI | InChI=1S/C16H15Br2NO/c1-9-7-12(8-10(2)15(9)18)19-16(20)13-5-4-6-14(17)11(13)3/h4-8H,1-3H3,(H,19,20) |
| InChIKey | ICKWSRSRPFUETA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.11 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |