C15H13BrINO — CID 107574838
N-(4-bromo-3,5-dimethylphenyl)-3-iodobenzamide (PubChem CID 107574838) has the molecular formula C15H13BrINO and a molecular weight of 430.08 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-3-iodobenzamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-3-iodobenzamide |
|---|---|
| PubChem CID | 107574838 |
| Molecular Formula | C15H13BrINO |
| Molecular Weight | 430.08 g/mol |
| Exact Mass | 428.92 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-3-iodobenzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(I)c2)cc(C)c1Br |
| InChI | InChI=1S/C15H13BrINO/c1-9-6-13(7-10(2)14(9)16)18-15(19)11-4-3-5-12(17)8-11/h3-8H,1-2H3,(H,18,19) |
| InChIKey | VBYDDEGMLXOLAX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.08 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|