C16H16BrNO2 — CID 107574824
N-(4-bromo-3,5-dimethylphenyl)-3-methoxybenzamide (PubChem CID 107574824) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-3-methoxybenzamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 107574824 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cc(C)c(Br)c(C)c2)c1 |
| InChI | InChI=1S/C16H16BrNO2/c1-10-7-13(8-11(2)15(10)17)18-16(19)12-5-4-6-14(9-12)20-3/h4-9H,1-3H3,(H,18,19) |
| InChIKey | DZBACONBSXYWFE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |