C16H15BrClNO — CID 107573025
N-(4-bromo-3,5-dimethylphenyl)-3-(chloromethyl)benzamide (PubChem CID 107573025) has the molecular formula C16H15BrClNO and a molecular weight of 352.66 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-3-(chloromethyl)benzamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-3-(chloromethyl)benzamide |
|---|---|
| PubChem CID | 107573025 |
| Molecular Formula | C16H15BrClNO |
| Molecular Weight | 352.66 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-3-(chloromethyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(CCl)c2)cc(C)c1Br |
| InChI | InChI=1S/C16H15BrClNO/c1-10-6-14(7-11(2)15(10)17)19-16(20)13-5-3-4-12(8-13)9-18/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | DTEVNXMQNMWGPS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|