C17H19NO — CID 925377
N-(3,5-dimethylphenyl)-2,4-dimethylbenzamide (PubChem CID 925377) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2,4-dimethylbenzamide.
| Compound Name | N-(3,5-dimethylphenyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 925377 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C17H19NO/c1-11-5-6-16(14(4)8-11)17(19)18-15-9-12(2)7-13(3)10-15/h5-10H,1-4H3,(H,18,19) |
| InChIKey | JWKBMIALMKPDOO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |