C15H14ClNO2 — CID 64788271
N-(4-chloro-3-hydroxyphenyl)-2,4-dimethylbenzamide (PubChem CID 64788271) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is N-(4-chloro-3-hydroxyphenyl)-2,4-dimethylbenzamide.
| Compound Name | N-(4-chloro-3-hydroxyphenyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 64788271 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-(4-chloro-3-hydroxyphenyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Cl)c(O)c2)c(C)c1 |
| InChI | InChI=1S/C15H14ClNO2/c1-9-3-5-12(10(2)7-9)15(19)17-11-4-6-13(16)14(18)8-11/h3-8,18H,1-2H3,(H,17,19) |
| InChIKey | INWJSNUYDPURAQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |