C19H23NO — CID 4028729
N-(4-butan-2-ylphenyl)-2,4-dimethylbenzamide (PubChem CID 4028729) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-2,4-dimethylbenzamide.
| Compound Name | N-(4-butan-2-ylphenyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 4028729 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-2,4-dimethylbenzamide |
| SMILES | CCC(C)c1ccc(NC(=O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H23NO/c1-5-14(3)16-7-9-17(10-8-16)20-19(21)18-11-6-13(2)12-15(18)4/h6-12,14H,5H2,1-4H3,(H,20,21) |
| InChIKey | KZDOBHAYRINLLL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |