C17H17Cl2NO — CID 966188
N-[4-[(2R)-butan-2-yl]phenyl]-2,5-dichlorobenzamide (PubChem CID 966188) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[4-[(2R)-butan-2-yl]phenyl]-2,5-dichlorobenzamide.
| Compound Name | N-[4-[(2R)-butan-2-yl]phenyl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 966188 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[4-[(2R)-butan-2-yl]phenyl]-2,5-dichlorobenzamide |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO/c1-3-11(2)12-4-7-14(8-5-12)20-17(21)15-10-13(18)6-9-16(15)19/h4-11H,3H2,1-2H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | GWRWCXOUUZPXHS-LLVKDONJSA-N |
| XLogP | 5.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |