C17H18ClNOS — CID 135491475
N-(4-butan-2-ylphenyl)-5-chloro-2-hydroxybenzenecarbothioamide (PubChem CID 135491475) has the molecular formula C17H18ClNOS and a molecular weight of 319.86 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-5-chloro-2-hydroxybenzenecarbothioamide.
| Compound Name | N-(4-butan-2-ylphenyl)-5-chloro-2-hydroxybenzenecarbothioamide |
|---|---|
| PubChem CID | 135491475 |
| Molecular Formula | C17H18ClNOS |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-5-chloro-2-hydroxybenzenecarbothioamide |
| SMILES | CCC(C)c1ccc(NC(=S)c2cc(Cl)ccc2O)cc1 |
| InChI | InChI=1S/C17H18ClNOS/c1-3-11(2)12-4-7-14(8-5-12)19-17(21)15-10-13(18)6-9-16(15)20/h4-11,20H,3H2,1-2H3,(H,19,21) |
| InChIKey | YWPPPGJZZKWQDW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|