C17H17Cl2NO2 — CID 4850845
N-(4-butan-2-ylphenyl)-3,5-dichloro-4-hydroxybenzamide (PubChem CID 4850845) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-3,5-dichloro-4-hydroxybenzamide.
| Compound Name | N-(4-butan-2-ylphenyl)-3,5-dichloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 4850845 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-3,5-dichloro-4-hydroxybenzamide |
| SMILES | CCC(C)c1ccc(NC(=O)c2cc(Cl)c(O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17Cl2NO2/c1-3-10(2)11-4-6-13(7-5-11)20-17(22)12-8-14(18)16(21)15(19)9-12/h4-10,21H,3H2,1-2H3,(H,20,22) |
| InChIKey | SRIBVKNBFZIRFW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |