C20H24N2O2S — CID 1396065
N-[[5-[(2S)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]-2,4-dimethylbenzamide (PubChem CID 1396065) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[[5-[(2S)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]-2,4-dimethylbenzamide.
| Compound Name | N-[[5-[(2S)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 1396065 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[[5-[(2S)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]-2,4-dimethylbenzamide |
| SMILES | CC[C@H](C)c1ccc(O)c(NC(=S)NC(=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C20H24N2O2S/c1-5-13(3)15-7-9-18(23)17(11-15)21-20(25)22-19(24)16-8-6-12(2)10-14(16)4/h6-11,13,23H,5H2,1-4H3,(H2,21,22,24,25)/t13-/m0/s1 |
| InChIKey | PYWINPGVYIKUKQ-ZDUSSCGKSA-N |
| XLogP | 4.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|