C22H22N2O2S — CID 1344927
N-[[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 1344927) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 1344927 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | CC[C@@H](C)c1ccc(O)c(NC(=S)NC(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H22N2O2S/c1-3-14(2)16-11-12-20(25)19(13-16)23-22(27)24-21(26)18-10-6-8-15-7-4-5-9-17(15)18/h4-14,25H,3H2,1-2H3,(H2,23,24,26,27)/t14-/m1/s1 |
| InChIKey | SZQNVBJLDVMCLV-CQSZACIVSA-N |
| XLogP | 5.19 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|