C19H20Br2N2O3S — CID 26019751
3,5-dibromo-N-[[5-[(2S)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 26019751) has the molecular formula C19H20Br2N2O3S and a molecular weight of 516.26 g/mol. Its IUPAC name is 3,5-dibromo-N-[[5-[(2S)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[[5-[(2S)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 26019751 |
| Molecular Formula | C19H20Br2N2O3S |
| Molecular Weight | 516.26 g/mol |
| Exact Mass | 513.96 |
| IUPAC Name | 3,5-dibromo-N-[[5-[(2S)-butan-2-yl]-2-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CC[C@H](C)c1ccc(O)c(NC(=S)NC(=O)c2cc(Br)cc(Br)c2OC)c1 |
| InChI | InChI=1S/C19H20Br2N2O3S/c1-4-10(2)11-5-6-16(24)15(7-11)22-19(27)23-18(25)13-8-12(20)9-14(21)17(13)26-3/h5-10,24H,4H2,1-3H3,(H2,22,23,25,27)/t10-/m0/s1 |
| InChIKey | VEGFWXSSDOSFCC-JTQLQIEISA-N |
| XLogP | 5.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.26 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|