C17H15Br2ClN2O4S — CID 17314585
3,5-dibromo-N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-2-methoxybenzamide (PubChem CID 17314585) has the molecular formula C17H15Br2ClN2O4S and a molecular weight of 538.65 g/mol. Its IUPAC name is 3,5-dibromo-N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17314585 |
| Molecular Formula | C17H15Br2ClN2O4S |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 535.88 |
| IUPAC Name | 3,5-dibromo-N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2cc(Br)cc(Br)c2OC)c(OC)cc1Cl |
| InChI | InChI=1S/C17H15Br2ClN2O4S/c1-24-13-7-12(14(25-2)6-11(13)20)21-17(27)22-16(23)9-4-8(18)5-10(19)15(9)26-3/h4-7H,1-3H3,(H2,21,22,23,27) |
| InChIKey | AJVPCZZBEGWMFM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|