C16H13Br2N3O5S — CID 17316980
3,5-dibromo-2-methoxy-N-[(4-methoxy-3-nitrophenyl)carbamothioyl]benzamide (PubChem CID 17316980) has the molecular formula C16H13Br2N3O5S and a molecular weight of 519.17 g/mol. Its IUPAC name is 3,5-dibromo-2-methoxy-N-[(4-methoxy-3-nitrophenyl)carbamothioyl]benzamide.
| Compound Name | 3,5-dibromo-2-methoxy-N-[(4-methoxy-3-nitrophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17316980 |
| Molecular Formula | C16H13Br2N3O5S |
| Molecular Weight | 519.17 g/mol |
| Exact Mass | 516.89 |
| IUPAC Name | 3,5-dibromo-2-methoxy-N-[(4-methoxy-3-nitrophenyl)carbamothioyl]benzamide |
| SMILES | COc1ccc(NC(=S)NC(=O)c2cc(Br)cc(Br)c2OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13Br2N3O5S/c1-25-13-4-3-9(7-12(13)21(23)24)19-16(27)20-15(22)10-5-8(17)6-11(18)14(10)26-2/h3-7H,1-2H3,(H2,19,20,22,27) |
| InChIKey | PQHMEYTXCVVONQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.17 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|