C26H25Br2N3O3S — CID 21171924
3,5-dibromo-N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 21171924) has the molecular formula C26H25Br2N3O3S and a molecular weight of 619.38 g/mol. Its IUPAC name is 3,5-dibromo-N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 21171924 |
| Molecular Formula | C26H25Br2N3O3S |
| Molecular Weight | 619.38 g/mol |
| Exact Mass | 617.00 |
| IUPAC Name | 3,5-dibromo-N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1c(Br)cc(Br)cc1C(=O)NC(=S)Nc1cccc(NC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C26H25Br2N3O3S/c1-26(2,3)16-10-8-15(9-11-16)23(32)29-18-6-5-7-19(14-18)30-25(35)31-24(33)20-12-17(27)13-21(28)22(20)34-4/h5-14H,1-4H3,(H,29,32)(H2,30,31,33,35) |
| InChIKey | XTOHEDCXMPDPFD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.38 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|