C16H11Br2ClN2O4S — CID 4506185
4-chloro-3-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]benzoic acid (PubChem CID 4506185) has the molecular formula C16H11Br2ClN2O4S and a molecular weight of 522.60 g/mol. Its IUPAC name is 4-chloro-3-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 4-chloro-3-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 4506185 |
| Molecular Formula | C16H11Br2ClN2O4S |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 519.85 |
| IUPAC Name | 4-chloro-3-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]benzoic acid |
| SMILES | COc1c(Br)cc(Br)cc1C(=O)NC(=S)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C16H11Br2ClN2O4S/c1-25-13-9(5-8(17)6-10(13)18)14(22)21-16(26)20-12-4-7(15(23)24)2-3-11(12)19/h2-6H,1H3,(H,23,24)(H2,20,21,22,26) |
| InChIKey | JZJAVWZPDARNEM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|