C13H9Br2N3O4S2 — CID 19205272
4,5-dibromo-N-[(4-methoxy-3-nitrophenyl)carbamothioyl]thiophene-2-carboxamide (PubChem CID 19205272) has the molecular formula C13H9Br2N3O4S2 and a molecular weight of 495.17 g/mol. Its IUPAC name is 4,5-dibromo-N-[(4-methoxy-3-nitrophenyl)carbamothioyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[(4-methoxy-3-nitrophenyl)carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19205272 |
| Molecular Formula | C13H9Br2N3O4S2 |
| Molecular Weight | 495.17 g/mol |
| Exact Mass | 492.84 |
| IUPAC Name | 4,5-dibromo-N-[(4-methoxy-3-nitrophenyl)carbamothioyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=S)NC(=O)c2cc(Br)c(Br)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9Br2N3O4S2/c1-22-9-3-2-6(4-8(9)18(20)21)16-13(23)17-12(19)10-5-7(14)11(15)24-10/h2-5H,1H3,(H2,16,17,19,23) |
| InChIKey | WLSNEWDONRVGJF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.17 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|