C11H5Br2ClN2O3S — CID 78924091
4,5-dibromo-N-(3-chloro-4-nitrophenyl)thiophene-2-carboxamide (PubChem CID 78924091) has the molecular formula C11H5Br2ClN2O3S and a molecular weight of 440.50 g/mol. Its IUPAC name is 4,5-dibromo-N-(3-chloro-4-nitrophenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(3-chloro-4-nitrophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78924091 |
| Molecular Formula | C11H5Br2ClN2O3S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 437.81 |
| IUPAC Name | 4,5-dibromo-N-(3-chloro-4-nitrophenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(Cl)c1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H5Br2ClN2O3S/c12-6-4-9(20-10(6)13)11(17)15-5-1-2-8(16(18)19)7(14)3-5/h1-4H,(H,15,17) |
| InChIKey | LMEUEPOKZXGUER-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|