C15H13Br2NO3 — CID 3948715
3,5-dibromo-2-methoxy-N-(2-methoxyphenyl)benzamide (PubChem CID 3948715) has the molecular formula C15H13Br2NO3 and a molecular weight of 415.08 g/mol. Its IUPAC name is 3,5-dibromo-2-methoxy-N-(2-methoxyphenyl)benzamide.
| Compound Name | 3,5-dibromo-2-methoxy-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 3948715 |
| Molecular Formula | C15H13Br2NO3 |
| Molecular Weight | 415.08 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | 3,5-dibromo-2-methoxy-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1cc(Br)cc(Br)c1OC |
| InChI | InChI=1S/C15H13Br2NO3/c1-20-13-6-4-3-5-12(13)18-15(19)10-7-9(16)8-11(17)14(10)21-2/h3-8H,1-2H3,(H,18,19) |
| InChIKey | VRVVSLGXXZWZMG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.08 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |