C14H9Br3INO2 — CID 3452845
3,5-dibromo-N-(4-bromo-2-iodophenyl)-2-methoxybenzamide (PubChem CID 3452845) has the molecular formula C14H9Br3INO2 and a molecular weight of 589.85 g/mol. Its IUPAC name is 3,5-dibromo-N-(4-bromo-2-iodophenyl)-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-(4-bromo-2-iodophenyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 3452845 |
| Molecular Formula | C14H9Br3INO2 |
| Molecular Weight | 589.85 g/mol |
| Exact Mass | 586.72 |
| IUPAC Name | 3,5-dibromo-N-(4-bromo-2-iodophenyl)-2-methoxybenzamide |
| SMILES | COc1c(Br)cc(Br)cc1C(=O)Nc1ccc(Br)cc1I |
| InChI | InChI=1S/C14H9Br3INO2/c1-21-13-9(4-8(16)5-10(13)17)14(20)19-12-3-2-7(15)6-11(12)18/h2-6H,1H3,(H,19,20) |
| InChIKey | XQGHHACMMFSTEZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.85 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|