C16H15BrINO4 — CID 34749976
5-bromo-2-iodo-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 34749976) has the molecular formula C16H15BrINO4 and a molecular weight of 492.11 g/mol. Its IUPAC name is 5-bromo-2-iodo-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 5-bromo-2-iodo-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 34749976 |
| Molecular Formula | C16H15BrINO4 |
| Molecular Weight | 492.11 g/mol |
| Exact Mass | 490.92 |
| IUPAC Name | 5-bromo-2-iodo-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2cc(Br)ccc2I)cc(OC)c1OC |
| InChI | InChI=1S/C16H15BrINO4/c1-21-13-7-10(8-14(22-2)15(13)23-3)19-16(20)11-6-9(17)4-5-12(11)18/h4-8H,1-3H3,(H,19,20) |
| InChIKey | QCBJRKZLEMHAER-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.11 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|