C13H13BrN2O4S — CID 117087526
2-bromo-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 117087526) has the molecular formula C13H13BrN2O4S and a molecular weight of 373.23 g/mol. Its IUPAC name is 2-bromo-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-bromo-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 117087526 |
| Molecular Formula | C13H13BrN2O4S |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 2-bromo-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1cc(NC(=O)c2csc(Br)n2)cc(OC)c1OC |
| InChI | InChI=1S/C13H13BrN2O4S/c1-18-9-4-7(5-10(19-2)11(9)20-3)15-12(17)8-6-21-13(14)16-8/h4-6H,1-3H3,(H,15,17) |
| InChIKey | LFFMRABFKBOBBW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |