C14H14BrNO4S — CID 43424437
5-bromo-N-(3,4,5-trimethoxyphenyl)thiophene-3-carboxamide (PubChem CID 43424437) has the molecular formula C14H14BrNO4S and a molecular weight of 372.24 g/mol. Its IUPAC name is 5-bromo-N-(3,4,5-trimethoxyphenyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-(3,4,5-trimethoxyphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 43424437 |
| Molecular Formula | C14H14BrNO4S |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 5-bromo-N-(3,4,5-trimethoxyphenyl)thiophene-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2csc(Br)c2)cc(OC)c1OC |
| InChI | InChI=1S/C14H14BrNO4S/c1-18-10-5-9(6-11(19-2)13(10)20-3)16-14(17)8-4-12(15)21-7-8/h4-7H,1-3H3,(H,16,17) |
| InChIKey | YKTCJXQGZBXWDM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |