C15H15BrN2O4 — CID 1267701
5-bromo-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 1267701) has the molecular formula C15H15BrN2O4 and a molecular weight of 367.20 g/mol. Its IUPAC name is 5-bromo-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1267701 |
| Molecular Formula | C15H15BrN2O4 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 5-bromo-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cncc(Br)c2)cc(OC)c1OC |
| InChI | InChI=1S/C15H15BrN2O4/c1-20-12-5-11(6-13(21-2)14(12)22-3)18-15(19)9-4-10(16)8-17-7-9/h4-8H,1-3H3,(H,18,19) |
| InChIKey | MELFSZUGGCYUBT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |