C16H15BrFNO4 — CID 110426879
3-bromo-5-fluoro-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 110426879) has the molecular formula C16H15BrFNO4 and a molecular weight of 384.20 g/mol. Its IUPAC name is 3-bromo-5-fluoro-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 3-bromo-5-fluoro-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 110426879 |
| Molecular Formula | C16H15BrFNO4 |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 3-bromo-5-fluoro-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2cc(F)cc(Br)c2)cc(OC)c1OC |
| InChI | InChI=1S/C16H15BrFNO4/c1-21-13-7-12(8-14(22-2)15(13)23-3)19-16(20)9-4-10(17)6-11(18)5-9/h4-8H,1-3H3,(H,19,20) |
| InChIKey | HPHKPQJTGLDJCH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |