C21H29N3O4 — CID 109241100
5-(dipropylamino)-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 109241100) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 5-(dipropylamino)-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-(dipropylamino)-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109241100 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 5-(dipropylamino)-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | CCCN(CCC)c1cncc(C(=O)Nc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H29N3O4/c1-6-8-24(9-7-2)17-10-15(13-22-14-17)21(25)23-16-11-18(26-3)20(28-5)19(12-16)27-4/h10-14H,6-9H2,1-5H3,(H,23,25) |
| InChIKey | ZTHCXXZANVOEAL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |