C11H6BrF2NOS — CID 39642819
5-bromo-N-(3,5-difluorophenyl)thiophene-3-carboxamide (PubChem CID 39642819) has the molecular formula C11H6BrF2NOS and a molecular weight of 318.14 g/mol. Its IUPAC name is 5-bromo-N-(3,5-difluorophenyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-(3,5-difluorophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 39642819 |
| Molecular Formula | C11H6BrF2NOS |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | 5-bromo-N-(3,5-difluorophenyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)c1csc(Br)c1 |
| InChI | InChI=1S/C11H6BrF2NOS/c12-10-1-6(5-17-10)11(16)15-9-3-7(13)2-8(14)4-9/h1-5H,(H,15,16) |
| InChIKey | YFTZQEMMRJGOFS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |