C12H7BrF2OS — CID 105412119
1-(5-bromothiophen-3-yl)-2-(3,5-difluorophenyl)ethanone (PubChem CID 105412119) has the molecular formula C12H7BrF2OS and a molecular weight of 317.15 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-2-(3,5-difluorophenyl)ethanone.
| Compound Name | 1-(5-bromothiophen-3-yl)-2-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 105412119 |
| Molecular Formula | C12H7BrF2OS |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-2-(3,5-difluorophenyl)ethanone |
| SMILES | O=C(Cc1cc(F)cc(F)c1)c1csc(Br)c1 |
| InChI | InChI=1S/C12H7BrF2OS/c13-12-4-8(6-17-12)11(16)3-7-1-9(14)5-10(15)2-7/h1-2,4-6H,3H2 |
| InChIKey | UCBLBDIVENQDTI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |