C8H6BrF3OS — CID 105106783
1-(5-bromothiophen-3-yl)-4,4,4-trifluorobutan-1-one (PubChem CID 105106783) has the molecular formula C8H6BrF3OS and a molecular weight of 287.10 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(5-bromothiophen-3-yl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 105106783 |
| Molecular Formula | C8H6BrF3OS |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 285.93 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)c1csc(Br)c1 |
| InChI | InChI=1S/C8H6BrF3OS/c9-7-3-5(4-14-7)6(13)1-2-8(10,11)12/h3-4H,1-2H2 |
| InChIKey | RNQRKYWKNKMTJB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |