C16H14F2OS — CID 106848111
2-(3,5-difluorophenyl)-1-(4-ethylsulfanylphenyl)ethanone (PubChem CID 106848111) has the molecular formula C16H14F2OS and a molecular weight of 292.35 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-(4-ethylsulfanylphenyl)ethanone.
| Compound Name | 2-(3,5-difluorophenyl)-1-(4-ethylsulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 106848111 |
| Molecular Formula | C16H14F2OS |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-(4-ethylsulfanylphenyl)ethanone |
| SMILES | CCSc1ccc(C(=O)Cc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C16H14F2OS/c1-2-20-15-5-3-12(4-6-15)16(19)9-11-7-13(17)10-14(18)8-11/h3-8,10H,2,9H2,1H3 |
| InChIKey | BLASTMNTDYADAA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |